Freepats project
Free and open instrument sets, samples, sound synthesis, music...
External links
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
Free and open instrument sets, samples, sound synthesis, music...
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Size | Description |
|---|---|---|---|
![[DIR]](/icons/back.gif){kind=icon} | Parent Directory | - | - |
![[SND]](/icons/sound2.gif){kind=icon} | TenorTrombone.ff.C3B3.flac | 1.0M | - |
| TenorTrombone.ff.C4B4.flac | 1.2M | - |
| TenorTrombone.ff.C5.flac | 112K | - |
| TenorTrombone.ff.E2B2.flac | 641K | - |
| TenorTrombone.mf.C3B3.flac | 588K | - |
| TenorTrombone.mf.C4B4.flac | 667K | - |
| TenorTrombone.mf.C5.flac | 56K | - |
| TenorTrombone.mf.E2B2.flac | 480K | - |
| TenorTrombone.pp.C3B3.flac | 511K | - |
| TenorTrombone.pp.C4B4.flac | 518K | - |
| TenorTrombone.pp.C5.flac | 45K | - |
| TenorTrombone.pp.E2B2.flac | 313K | - |