Freepats project
Free and open instrument sets, samples, sound synthesis, music...
External links
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
Free and open instrument sets, samples, sound synthesis, music...
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Size | Description |
|---|---|---|---|
![[DIR]](/icons/back.gif){kind=icon} | Parent Directory | - | - |
![[SND]](/icons/sound2.gif){kind=icon} | foscilHail.flac | 712K | - |
| foscilfreakout.flac | 859K | - |
| foscilfreakout3.flac | 1.5M | - |
| foscilfreakout4.flac | 811K | - |
| foscilfreakout5.flac | 111K | - |
| foscilfreakout6.flac | 881K | - |
| foscilfreakout7.flac | 574K | - |
| pianofeedbackstrum.flac | 896K | - |
| pianofeedbackstrum2.flac | 1.1M | - |
| pianohighstrum.flac | 1.0M | - |
| pianohighstrum2.flac | 1.4M | - |
| pianolongstrum.flac | 1.3M | - |
| pianolongstrum2.flac | 1.2M | - |
| pianoshortstrum.flac | 154K | - |
| pianosmash1.flac | 591K | - |
| pianosmash2.flac | 437K | - |
| pianosmash3.flac | 465K | - |
| pianosmash4.flac | 367K | - |
| pianosmash5.flac | 223K | - |
| pianosmash6.flac | 631K | - |
| pianosoundboardhit.flac | 234K | - |