Freepats project
Free and open instrument sets, samples, sound synthesis, music...
External links
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
Free and open instrument sets, samples, sound synthesis, music...
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Size | Description |
|---|---|---|---|
![[DIR]](/icons/back.gif){kind=icon} | Parent Directory | - | - |
![[SND]](/icons/sound2.gif){kind=icon} | babylaugh1.flac | 253K | - |
| babylaugh2.flac | 114K | - |
| babylaugh3.flac | 111K | - |
| bottle1.flac | 18K | - |
| carhorn.flac | 164K | - |
| door1.flac | 26K | - |
| door2.flac | 26K | - |
| door3.flac | 38K | - |
| door4.flac | 41K | - |
| door5.flac | 36K | - |
| door6.flac | 27K | - |
| fingersnap.flac | 60K | - |
| glassbreak1.flac | 169K | - |
| glassbreak2.flac | 37K | - |
| guitar_muted.flac | 13K | - |
| noise_seashore.flac | 279K | - |
| noise_traffic.flac | 632K | - |
| sine_1000hz.flac | 93K | - |
| sine_middle_c.flac | 52K | - |
| speak_hahaha.flac | 44K | - |
| speak_hello.flac | 41K | - |
| voicefemale_ah1.flac | 87K | - |
| voicefemale_ah2.flac | 24K | - |
| voicemale_la.flac | 117K | - |
| voicesynth_ah.flac | 61K | - |
| voicesynth_oh.flac | 57K | - |