Freepats project
Free and open instrument sets, samples, sound synthesis, music...
External links
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
Free and open instrument sets, samples, sound synthesis, music...
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Size | Description |
|---|---|---|---|
![[DIR]](/icons/back.gif){kind=icon} | Parent Directory | - | - |
![[SND]](/icons/sound2.gif){kind=icon} | feedback_1.flac | 444K | - |
| feedback_2.flac | 453K | - |
| feedback_efx_1.flac | 233K | - |
| feedback_efx_2.flac | 140K | - |
| guitar_Astring.flac | 295K | - |
| guitar_Bstring.flac | 255K | - |
| guitar_Dstring.flac | 379K | - |
| guitar_Gstring.flac | 334K | - |
| guitar_LowEstring1.flac | 219K | - |
| guitar_LowEstring2.flac | 242K | - |
| guitar_chord1.flac | 158K | - |
| guitar_chord2.flac | 168K | - |
| guitar_chord3.flac | 138K | - |
| guitar_chord4.flac | 128K | - |
| guitar_highEstring.flac | 190K | - |
| guitar_hit_!.flac | 392K | - |
| guitar_hit_2.flac | 462K | - |
| guitar_pick_1.flac | 141K | - |
| guitar_pick_2.flac | 133K | - |
| guitar_pick_3.flac | 312K | - |
| guitar_riff_cutup1.flac | 228K | - |
| guitar_riff_cutup2.flac | 225K | - |
| guitar_riff_cutup3.flac | 172K | - |
| guitar_riff_cutup4.flac | 458K | - |
| guitar_riff_cutup5.flac | 910K | - |
| guitar_scrape_1.flac | 184K | - |
| guitar_scrape_2.flac | 185K | - |
| mcbridetone_1.flac | 1.4M | - |