Freepats project
Free and open instrument sets, samples, sound synthesis, music...
External links
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
Free and open instrument sets, samples, sound synthesis, music...
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Size | Description |
|---|---|---|---|
![[DIR]](/icons/back.gif){kind=icon} | Parent Directory | - | - |
![[SND]](/icons/sound2.gif){kind=icon} | bottle.flac | 217K | - |
| bottleambient.flac | 293K | - |
| drumkit_crash.flac | 203K | - |
| drumkit_hihatclosed.flac | 32K | - |
| drumkit_hihatopen.flac | 152K | - |
| drumkit_kick.flac | 36K | - |
| drumkit_ride.flac | 243K | - |
| drumkit_snare.flac | 45K | - |
| drumkit_tomfloor.flac | 71K | - |
| drumkit_tomrack.flac | 35K | - |
| drumpattern1.flac | 159K | - |
| drumpattern2.flac | 150K | - |
| drumpattern3.flac | 167K | - |
| thumbpiano_Do1.flac | 86K | - |
| thumbpiano_do.flac | 124K | - |
| thumbpiano_mi.flac | 129K | - |
| thumbpiano_mi2.flac | 80K | - |
| thumbpiano_re2.flac | 80K | - |
| thumbpiano_so.flac | 84K | - |
| thumbpiano_te.flac | 84K | - |
| thumbtunedAmixo_do.flac | 86K | - |
| thumbtunedAmixo_do2.flac | 79K | - |
| thumbtunedAmixo_mi.flac | 112K | - |
| thumbtunedAmixo_mi2.flac | 78K | - |
| thumbtunedAmixo_so.flac | 79K | - |
| thumbtunedAmixo_te.flac | 82K | - |