Freepats project
Free and open instrument sets, samples, sound synthesis, music...
External links
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
Free and open instrument sets, samples, sound synthesis, music...
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Size | Description |
|---|---|---|---|
![[DIR]](/icons/back.gif){kind=icon} | Parent Directory | - | - |
![[SND]](/icons/sound2.gif){kind=icon} | chimes.flac | 680K | - |
| phoneme_b.flac | 19K | - |
| phoneme_ch1.flac | 17K | - |
| phoneme_ch2.flac | 19K | - |
| phoneme_d1.flac | 26K | - |
| phoneme_d2.flac | 26K | - |
| phoneme_d3.flac | 25K | - |
| phoneme_d4.flac | 24K | - |
| phoneme_dh.flac | 24K | - |
| phoneme_g.flac | 16K | - |
| phoneme_j.flac | 20K | - |
| phoneme_k.flac | 21K | - |
| phoneme_kh.flac | 19K | - |
| phoneme_p.flac | 19K | - |
| phoneme_s1.flac | 28K | - |
| phoneme_s2.flac | 27K | - |
| phoneme_sh.flac | 20K | - |
| phoneme_t-voiced.flac | 25K | - |
| phoneme_t1.flac | 17K | - |
| phoneme_t2.flac | 17K | - |
| phoneme_t3.flac | 20K | - |
| phoneme_t4.flac | 17K | - |
| phoneme_z.flac | 33K | - |
| phoneme_zh.flac | 33K | - |
| vocalStretch_Liz-noise-1-6x.flac | 968K | - |
| vocalStretch_Liz-noise-1.flac | 171K | - |
| vocalStretch_it-8x-30x.flac | 1.1M | - |
| vocalStretch_it-8x.flac | 45K | - |