Freepats project
Free and open instrument sets, samples, sound synthesis, music...
External links
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
Free and open instrument sets, samples, sound synthesis, music...
FluidSynth: software synthesizer based on the SF2 specifications.
Swami: editor for MIDI instruments and sounds.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Size | Description |
|---|---|---|---|
![[DIR]](/icons/back.gif){kind=icon} | Parent Directory | - | - |
![[TXT]](/icons/layout.gif){kind=icon} | README.htm | 364 | - |
| bass.pat | 35K | - |
| crystal.pat | 148K | - |
| flute.pat | 206K | - |
| guitar.pat | 168K | - |
| lead.pat | 68K | - |
| noise.pat | 13K | - |
| organ.pat | 57K | - |
| pad.pat | 67K | - |
| piano.pat | 103K | - |
| sax.pat | 20K | - |
| sitar.pat | 63K | - |
| timidity.cfg | 5.5K | - |
| trumpl.pat | 158K | - |
| violin.pat | 50K | - |
| voice.pat | 41K | - |
| wood.pat | 11K | - |
| xylo.pat | 37K | - |